Products 1378846-01-5

CAS 1378846-01-5 is the registry number for 3-Hydroxy-1-oxo-1,3-dihydroisobenzofuran-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-hydroxy-1-oxo-3H-2-benzofuran-5-carboxylic acid (CAS 1378846-01-5) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 3-hydroxy-1-oxo-3H-2-benzofuran-5-carboxylic acid. InChIKey: LROCRUXBQGFESS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6O5
Molecular weight194.14 g/mol
IUPAC name3-hydroxy-1-oxo-3H-2-benzofuran-5-carboxylic acid
InChIKeyLROCRUXBQGFESS-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)C(OC2=O)O

Computed by PubChem (NCBI)