CAS 62869-57-2 appears in our catalog under these names: 12-Hydroxy-4,6,11-trioxatricyclo(7.3.0.0,3,7)dodeca-1,3(7),8-trien-10-one, 7-Hydroxy-[1,3]dioxolo[4,5-f]isobenzofuran-5(7H)-one 97%, 7-Hydroxy-[1,3]dioxolo[4,5-f]isobenzofuran-5(7H)-one, 97%, 97%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
5-hydroxy-5H-furo[3,4-f][1,3]benzodioxol-7-one (CAS 62869-57-2) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 5-hydroxy-5H-furo[3,4-f][1,3]benzodioxol-7-one. InChIKey: OMWWLAWOSZODOO-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 5-hydroxy-5H-furo[3,4-f][1,3]benzodioxol-7-one |
| InChIKey | OMWWLAWOSZODOO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(OC3=O)O |
Computed by PubChem (NCBI)