CAS 147942-92-5 is the registry number for 3,4,8-Trihydroxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,8-trihydroxychromen-2-one (CAS 147942-92-5) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 3,4,8-trihydroxychromen-2-one. InChIKey: OJIYXYUCRVFSRV-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 3,4,8-trihydroxychromen-2-one |
| InChIKey | OJIYXYUCRVFSRV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C(=C2O)O |
Computed by PubChem (NCBI)