Products 66998-60-5
CAS 66998-60-5 appears in our catalog under these names: 5-Formylisophthalic acid, 97%, 5-Formylisophthalic acid, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-formylbenzene-1,3-dicarboxylic acid (CAS 66998-60-5) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 5-formylbenzene-1,3-dicarboxylic acid. InChIKey: INXZLJLREDVXKV-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 5-formylbenzene-1,3-dicarboxylic acid |
| InChIKey | INXZLJLREDVXKV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C=O |
Computed by PubChem (NCBI)