CAS 528-46-1 is the registry number for 2–(Carboxycarbonyl)benzoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-oxalobenzoic acid (CAS 528-46-1) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 2-oxalobenzoic acid. InChIKey: LFLOMAIEONDOLV-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 2-oxalobenzoic acid |
| InChIKey | LFLOMAIEONDOLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)