CAS 17575-26-7 appears in our catalog under these names: 4,5,7-Trihydroxycoumarin, 95%, 4,5,7-Trihydroxy-2H-chromen-2-one, 95+%, 4,5,7-Trihydroxy-2H-chromen-2-one. Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g.
4,5,7-trihydroxychromen-2-one (CAS 17575-26-7) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 4,5,7-trihydroxychromen-2-one. InChIKey: HPNWGYCBCHLEMW-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 4,5,7-trihydroxychromen-2-one |
| InChIKey | HPNWGYCBCHLEMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1O)C(=CC(=O)O2)O)O |
Computed by PubChem (NCBI)