cas: 32292-78-7 — see every product listed under this CAS number, including other names
2-(Benzoyloxy)-4,6-dihydroxybenzaldehyde, 95%, 95% (CAS 32292-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GZM-100mg |
| cas | 32292-78-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 885.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-formyl-3,5-dihydroxyphenyl) benzoate (CAS 32292-78-7) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: (2-formyl-3,5-dihydroxyphenyl) benzoate. InChIKey: NQGFNZGQTUVDDL-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | (2-formyl-3,5-dihydroxyphenyl) benzoate |
| InChIKey | NQGFNZGQTUVDDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC(=CC(=C2C=O)O)O |
Computed by PubChem (NCBI)