CAS 2513-33-9 appears in our catalog under these names: Acetylsalicylic Acid (Aspirin) Impurity 4, 2',4'-Dihydroxy-2-benzoylbenzoic Acid, >95% (HPLC), 2-(2,4-Dihydroxybenzoyl)benzoic Acid, 2′,4′–Dihydroxy–2–benzoylbenzoic Acid, Fluorescein impurity C 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TargetMol. Available pack sizes: on request, 10g, 1g, 4x25mg, 25mg, 100mg, 250mg, 5g.
2-(2,4-dihydroxybenzoyl)benzoic acid (CAS 2513-33-9) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 2-(2,4-dihydroxybenzoyl)benzoic acid. InChIKey: KIEFFPFIBREPIX-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 2-(2,4-dihydroxybenzoyl)benzoic acid |
| InChIKey | KIEFFPFIBREPIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=C(C=C2)O)O)C(=O)O |
Computed by PubChem (NCBI)