Products 40677-31-4

CAS 40677-31-4 is the registry number for Propofol Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(4-hydroxybenzoyl)oxybenzoic acid (CAS 40677-31-4) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 4-(4-hydroxybenzoyl)oxybenzoic acid. InChIKey: XEWYFIXXJRNLJV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10O5
Molecular weight258.23 g/mol
IUPAC name4-(4-hydroxybenzoyl)oxybenzoic acid
InChIKeyXEWYFIXXJRNLJV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)