CAS 713519-19-8 is the registry number for 8-O-Methyl-urolithin C. Offered by: TRC. Available pack sizes: 100mg, 10mg.
3,9-dihydroxy-8-methoxybenzo[c]chromen-6-one (CAS 713519-19-8) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 3,9-dihydroxy-8-methoxybenzo[c]chromen-6-one. InChIKey: VSSKAHKUAQIXLE-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 3,9-dihydroxy-8-methoxybenzo[c]chromen-6-one |
| InChIKey | VSSKAHKUAQIXLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C3=C(C=C(C=C3)O)OC(=O)C2=C1)O |
Computed by PubChem (NCBI)