CAS 909867-52-3 is the registry number for 2-Acetyl-5-hydroxy-2,3-dihydronaphtho[2,3-b]furan-4,9-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetyl-5-hydroxy-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (CAS 909867-52-3) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 2-acetyl-5-hydroxy-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione. InChIKey: DWMJEEGBCMSGAH-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 2-acetyl-5-hydroxy-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| InChIKey | DWMJEEGBCMSGAH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC2=C(O1)C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)