Products 1261889-89-7
CAS 1261889-89-7 appears in our catalog under these names: 4-(3,5-Dicarboxyphenyl)phenol, 97%, 4-(3,5-Dicarboxyphenyl)phenol, >95% (HPLC), 4'–Hydroxy–(1,1'–biphenyl)–3,5–dicarboxylic acid, 4-(3,5-Dicarboxyphenyl)phenol 98%, 4-(3,5-Dicarboxyphenyl)phenol, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-(4-hydroxyphenyl)benzene-1,3-dicarboxylic acid (CAS 1261889-89-7) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 5-(4-hydroxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: PUEJCTNHESKEDO-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | PUEJCTNHESKEDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)