Products 37951-15-8
CAS 37951-15-8 appears in our catalog under these names: 4-Phenoxyphthalic acid, 95%, 4–Phenoxyphthalic acid, 4-Phenoxyphthalic acid 97%, 4-Phenoxyphthalic acid, 97%, 97%, 4-Phenoxyphthalic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
4-phenoxyphthalic acid (CAS 37951-15-8) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 4-phenoxyphthalic acid. InChIKey: FKDITAXSGNKBOZ-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 4-phenoxyphthalic acid |
| InChIKey | FKDITAXSGNKBOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)