2-(Benzoyloxy)benzoic acid, 95%
cas: 4578-66-9 — see every product listed under this CAS number, including other names
2-(Benzoyloxy)benzoic acid, 95% (CAS 4578-66-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1479161-100mg |
| cas | 4578-66-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1349.38 Pln | |
| Ambeed | 5g | 5193.06 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 880.40 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| BLDpharm | 5g | 5096.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-benzoyloxybenzoic acid (CAS 4578-66-9) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-benzoyloxybenzoic acid. InChIKey: QSOVSKMNRYAVJR-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-benzoyloxybenzoic acid |
| InChIKey | QSOVSKMNRYAVJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)