cas: 10262-65-4 — see every product listed under this CAS number, including other names
2-(Bromoacetyl)-6-methoxynaphthalene 95% (CAS 10262-65-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A356893-250mg |
| cas | 10262-65-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A356893 |
2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone (CAS 10262-65-4) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone. InChIKey: HHHKEQGAGUAOQI-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone |
| InChIKey | HHHKEQGAGUAOQI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)