cas: 142404-69-1 — see every product listed under this CAS number, including other names
2-(Chloro(4-chlorophenyl)methyl)pyridine, 98% (CAS 142404-69-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214813-1G |
| cas | 142404-69-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 643.54 Pln | |
| Fluorochem | 25g | 940.31 Pln | |
| Fluorochem | 100g | 3512.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[chloro-(4-chlorophenyl)methyl]pyridine (CAS 142404-69-1) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 2-[chloro-(4-chlorophenyl)methyl]pyridine. InChIKey: JJOZASAAOCISAR-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2-[chloro-(4-chlorophenyl)methyl]pyridine |
| InChIKey | JJOZASAAOCISAR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)