CAS 105836-68-8 appears in our catalog under these names: Diclofenac Impurity 28, 3,5–dichloro–N–phenylaniline. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 5g.
3,5-dichloro-N-phenylaniline (CAS 105836-68-8) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 3,5-dichloro-N-phenylaniline. InChIKey: RHCOKFKKJPTSKY-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3,5-dichloro-N-phenylaniline |
| InChIKey | RHCOKFKKJPTSKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)