CAS 2054859-59-3 is the registry number for 4,7-Dichloro-3-cyclopropylquinoline. Offered by: TRC. Available pack sizes: 100mg.
4,7-dichloro-3-cyclopropylquinoline (CAS 2054859-59-3) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4,7-dichloro-3-cyclopropylquinoline. InChIKey: XYBSBPBXNVQLQN-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4,7-dichloro-3-cyclopropylquinoline |
| InChIKey | XYBSBPBXNVQLQN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CN=C3C=C(C=CC3=C2Cl)Cl |
Computed by PubChem (NCBI)