cas: 16867-35-9 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-4H-pyrido(1,2-a)pyrimidin-4-one, 98% (CAS 16867-35-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A556315-10g |
| cas | 16867-35-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 3624.46 Pln | |
| AmBeed | 25g | 7178.92 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 16867-35-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: QANDFEYEAYUSKD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | QANDFEYEAYUSKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)CCl |
Computed by PubChem (NCBI)