cas: 16867-35-9 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one, 98%, 98% (CAS 16867-35-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABWH-50mg |
| cas | 16867-35-9 |
| size | 50mg |
| availability | 23g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 122.00 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 1970.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 16867-35-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: QANDFEYEAYUSKD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | QANDFEYEAYUSKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)CCl |
Computed by PubChem (NCBI)