2-(Cyclopropylamino)nicotinic acid, 97%
cas: 639807-18-4 — see every product listed under this CAS number, including other names
2-(Cyclopropylamino)nicotinic acid, 97% (CAS 639807-18-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A105140-1g |
| cas | 639807-18-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 270.25 Pln | |
| Ambeed | 100g | 859.88 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 142.20 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 286.59 Pln | |
| BLDpharm | 100g | 919.70 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(cyclopropylamino)pyridine-3-carboxylic acid (CAS 639807-18-4) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-(cyclopropylamino)pyridine-3-carboxylic acid. InChIKey: QVDNJGOBMXAPSJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-(cyclopropylamino)pyridine-3-carboxylic acid |
| InChIKey | QVDNJGOBMXAPSJ-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)