cas: 330792-68-2 — see every product listed under this CAS number, including other names
2-(Hydroxy(4-phenoxyphenyl)methylene)malononitrile, 99%, 99% (CAS 330792-68-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 15g, 25g, 50g, 100g, 200g, 300g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7HF-5g |
| cas | 330792-68-2 |
| size | 5g |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 15g | 136.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 467.60 Pln | |
| Chemat | 200g | 832.40 Pln | |
| Chemat | 300g | 1206.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[hydroxy-(4-phenoxyphenyl)methylidene]propanedinitrile (CAS 330792-68-2) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 2-[hydroxy-(4-phenoxyphenyl)methylidene]propanedinitrile. InChIKey: MWTPPIZIKZHMSK-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-[hydroxy-(4-phenoxyphenyl)methylidene]propanedinitrile |
| InChIKey | MWTPPIZIKZHMSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=C(C#N)C#N)O |
Computed by PubChem (NCBI)