CAS 906748-38-7 appears in our catalog under these names: (Z)-[2,3'-Biindolinylidene]-2',3-dione, 95%, (Z)-Indirubin 98%, (3Z)-3-(1,3-Dihydro-3-oxo-2H-indol-2-ylidene)-1,3-dihydro-2H-indol-2-one, 98%, 98%, (Z)-Indirubin, 99.95%, (Z)-Indirubin (Standard), 98.07%. Offered by: Combi-blocks, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 15g, 25g, 100 mg.
2-(2-hydroxy-1H-indol-3-yl)indol-3-one (CAS 906748-38-7) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(2-hydroxy-1H-indol-3-yl)indol-3-one. InChIKey: JNLNPCNGMHKCKO-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-(2-hydroxy-1H-indol-3-yl)indol-3-one |
| InChIKey | JNLNPCNGMHKCKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)C3=NC4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)