CAS 1032-97-9 appears in our catalog under these names: 3-(1H-Benzimidazol-2-yl)-2h-chromen-2-one, 95%, 3-(1H-Benzo(d)imidazol-2-yl)-2H-chromen-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
3-(1H-benzimidazol-2-yl)chromen-2-one (CAS 1032-97-9) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)chromen-2-one. InChIKey: YRFHFTBLQARMCG-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(1H-benzimidazol-2-yl)chromen-2-one |
| InChIKey | YRFHFTBLQARMCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)