CAS 476-34-6 appears in our catalog under these names: Isoindigo, 97%, Isoindigo, Isoindigotin/ 98%, Isoindigo 98%, Isoindigotin, ≥98%, ≥98%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10g, 25mg, 50mg, 10mM/1mL, 50 mg.
3-(2-hydroxy-1H-indol-3-yl)indol-2-one (CAS 476-34-6) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(2-hydroxy-1H-indol-3-yl)indol-2-one. InChIKey: VBMISAYWIMDRCV-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(2-hydroxy-1H-indol-3-yl)indol-2-one |
| InChIKey | VBMISAYWIMDRCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)C3=C4C=CC=CC4=NC3=O |
Computed by PubChem (NCBI)