CAS 15996-74-4 is the registry number for 4-[(1,3-Dioxoisoindol-2-yl)methyl]benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(1,3-dioxoisoindol-2-yl)methyl]benzonitrile (CAS 15996-74-4) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 4-[(1,3-dioxoisoindol-2-yl)methyl]benzonitrile. InChIKey: PAKQBGKIYWXTMG-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzonitrile |
| InChIKey | PAKQBGKIYWXTMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)