CAS 95339-61-0 is the registry number for 2-[3-(1,3-Dioxoisoindol-2-yl)phenyl]acetonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetonitrile (CAS 95339-61-0) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 2-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetonitrile. InChIKey: FQMAXEIWLQXXLM-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetonitrile |
| InChIKey | FQMAXEIWLQXXLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC(=C3)CC#N |
Computed by PubChem (NCBI)