CAS 397242-72-7 is the registry number for (E)-[2,3'-Biindolinylidene]-2',3-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-hydroxy-1H-indol-3-yl)indol-3-one (CAS 397242-72-7) is a chemical compound with the molecular formula C16H10N2O2 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(2-hydroxy-1H-indol-3-yl)indol-3-one. InChIKey: JNLNPCNGMHKCKO-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O2 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-(2-hydroxy-1H-indol-3-yl)indol-3-one |
| InChIKey | JNLNPCNGMHKCKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)C3=NC4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)