cas: 76067-81-7 — see every product listed under this CAS number, including other names
2-(Methacryloyloxy)ethyl 3,5-diaminobenzoate 98% (CAS 76067-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1264508-100mg |
| cas | 76067-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1388.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1264508 |
2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate (CAS 76067-81-7) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate. InChIKey: BZRAULNYWZRKMB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate |
| InChIKey | BZRAULNYWZRKMB-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)C1=CC(=CC(=C1)N)N |
Computed by PubChem (NCBI)