Products 1279039-31-4

CAS 1279039-31-4 is the registry number for (2S,4R)-4-Cbz-amino pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid (CAS 1279039-31-4) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: (2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid. InChIKey: VCZIKOUKWSDDIU-MNOVXSKESA-N.

Identity
Molecular formulaC13H16N2O4
Molecular weight264.28 g/mol
IUPAC name(2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid
InChIKeyVCZIKOUKWSDDIU-MNOVXSKESA-N
SMILESC1[C@H](CN[C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)