CAS 1279039-31-4 is the registry number for (2S,4R)-4-Cbz-amino pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid (CAS 1279039-31-4) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: (2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid. InChIKey: VCZIKOUKWSDDIU-MNOVXSKESA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
| InChIKey | VCZIKOUKWSDDIU-MNOVXSKESA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)