CAS 76067-81-7 appears in our catalog under these names: 2-(Methacryloyloxy)ethyl 3,5-diaminobenzoate, 95%, 2-(Methacryloyloxy)ethyl 3,5-diaminobenzoate, 98%, 2-(Methacryloyloxy)ethyl 3,5-Diaminobenzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate (CAS 76067-81-7) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate. InChIKey: BZRAULNYWZRKMB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyloxy)ethyl 3,5-diaminobenzoate |
| InChIKey | BZRAULNYWZRKMB-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)C1=CC(=CC(=C1)N)N |
Computed by PubChem (NCBI)