cas: 33963-55-2 — see every product listed under this CAS number, including other names
2-(Methylsulfonyl)benzoic acid, 97% (CAS 33963-55-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023354-1G |
| cas | 33963-55-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 25g | 2392.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-methylsulfonylbenzoic acid (CAS 33963-55-2) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-methylsulfonylbenzoic acid. InChIKey: BZSXEZOLBIJVQK-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-methylsulfonylbenzoic acid |
| InChIKey | BZSXEZOLBIJVQK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)