cas: 56734-10-2 — see every product listed under this CAS number, including other names
2-(Methylthio)-4-phenylpyrimidine 95% (CAS 56734-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109221-250mg |
| cas | 56734-10-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 2667.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109221 |
2-methylsulfanyl-4-phenylpyrimidine (CAS 56734-10-2) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 2-methylsulfanyl-4-phenylpyrimidine. InChIKey: LHQHZLLOGPDNGV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 2-methylsulfanyl-4-phenylpyrimidine |
| InChIKey | LHQHZLLOGPDNGV-UHFFFAOYSA-N |
| SMILES | CSC1=NC=CC(=N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)