CAS 6649-73-6 appears in our catalog under these names: 6–Phenyl–5,6–dihydroimidazo(2,1–b)thiazole, 6-Phenyl-5,6-dihydroimidazo[2,1-b]thiazole, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole (CAS 6649-73-6) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole. InChIKey: UPMCDOMOBNMTPH-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| InChIKey | UPMCDOMOBNMTPH-UHFFFAOYSA-N |
| SMILES | C1C(N=C2N1C=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)