CAS 338777-45-0 is the registry number for 2-(2,5-Dimethyl-1h-pyrrol-1-yl)thiophene-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonitrile (CAS 338777-45-0) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonitrile. InChIKey: UFKFWIMIVPBZQT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonitrile |
| InChIKey | UFKFWIMIVPBZQT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=CS2)C#N)C |
Computed by PubChem (NCBI)