CAS 34176-49-3 appears in our catalog under these names: 4,5-Dihydro-naphtho[1,2-d]thiazol-2-ylamine, 95%, 4,5-Dihydronaphtho(1,2-d)(1,3)thiazol-2-amine, 4,5-Dihydronaphtho[1,2-d]thiazol-2-ylamine, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 2g, 5g.
4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine (CAS 34176-49-3) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine. InChIKey: RKFXIXZWTWCVBR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
| InChIKey | RKFXIXZWTWCVBR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)N=C(S2)N |
Computed by PubChem (NCBI)