CAS 3394-04-5 appears in our catalog under these names: 1-(2-Naphthyl)-2-thiourea, 95%, beta-Naphthylthiourea. Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 5g, 1g, 250mg.
Naphthalen-2-ylthiourea (CAS 3394-04-5) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: naphthalen-2-ylthiourea. InChIKey: JCGVEGFEGJLZDW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | naphthalen-2-ylthiourea |
| InChIKey | JCGVEGFEGJLZDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=S)N |
Computed by PubChem (NCBI)