CAS 857412-75-0 is the registry number for 5-Methyl-4-phenyl-2-pyrimidinethiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-methyl-6-phenyl-1H-pyrimidine-2-thione (CAS 857412-75-0) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 5-methyl-6-phenyl-1H-pyrimidine-2-thione. InChIKey: AFFDJFDQEJGFDN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 5-methyl-6-phenyl-1H-pyrimidine-2-thione |
| InChIKey | AFFDJFDQEJGFDN-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=S)N=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)