CAS 401622-74-0 appears in our catalog under these names: 4,5-Dihydronaphtho[2,1-d][1,3]thiazol-2-amine, 98%, 4,5-Dihydronaphtho(2,1-d)(1,3)thiazol-2-amine, 4,5-Dihydronaphtho[2,1-d]thiazol-2-amine 95%, 4,5-DIHYDRONAPHTHO[2,1-D][1,3]THIAZOL-2-AMINE, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine (CAS 401622-74-0) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine. InChIKey: NBJZFXQLZREGNR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine |
| InChIKey | NBJZFXQLZREGNR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=N2)N |
Computed by PubChem (NCBI)