2-(Naphthalen-1-yl)acetyl chloride, 95%
cas: 5121-00-6 — see every product listed under this CAS number, including other names
2-(Naphthalen-1-yl)acetyl chloride, 95% (CAS 5121-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 250mg, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A785627-1g |
| cas | 5121-00-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 10g | 921.06 Pln | |
| Ambeed | 25g | 2194.88 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 636.47 Pln | |
| BLDpharm | 10g | 986.34 Pln | |
| BLDpharm | 25g | 2363.64 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-naphthalen-1-ylacetyl chloride (CAS 5121-00-6) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 2-naphthalen-1-ylacetyl chloride. InChIKey: DSVAZLXLRDXHKO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-naphthalen-1-ylacetyl chloride |
| InChIKey | DSVAZLXLRDXHKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(naphthalen-1-yl)acetyl chloride, 2-(1-Naphthyl)Ethanoyl Chloride, 1-Naphthylacetyl Chloride, 2-naphthalen-1-ylacetyl chloride, Naphth-1-ylacetyl chloride, (naphth-1-yl)acetyl chloride, 1-naphthylacetylchloride, 1-Naphthaleneacetyl chloride, 2-(Naphth-1-yl)ethanoyl chloride, napthylacetyl chloride