CAS 18773-38-1 appears in our catalog under these names: 2-Chloro-5-phenylphenol, 95%, 4-Chloro-3-hydroxybiphenyl, 95%, 4-Chloro[1,1'-biphenyl]-3-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-chloro-5-phenylphenol (CAS 18773-38-1) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 2-chloro-5-phenylphenol. InChIKey: JLOLMJZKXRFOOE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-chloro-5-phenylphenol |
| InChIKey | JLOLMJZKXRFOOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Cl)O |
Computed by PubChem (NCBI)