CAS 149950-34-5 appears in our catalog under these names: 3-(2-Chlorophenyl)phenol, 95%, 2'-Chloro-(1,1'-biphenyl)-3-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-(2-chlorophenyl)phenol (CAS 149950-34-5) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 3-(2-chlorophenyl)phenol. InChIKey: YQFPFQICZVMDML-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3-(2-chlorophenyl)phenol |
| InChIKey | YQFPFQICZVMDML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)O)Cl |
Computed by PubChem (NCBI)