CAS 28023-90-7 appears in our catalog under these names: 3-(4-Chlorophenyl)phenol, 95%, 4'-Chloro-(1,1'-biphenyl)-3-ol, 95%, 4-Chloro-3'-hydroxybiphenyl, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 500mg.
3-(4-chlorophenyl)phenol (CAS 28023-90-7) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 3-(4-chlorophenyl)phenol. InChIKey: CIPDQYWUAVNLSD-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3-(4-chlorophenyl)phenol |
| InChIKey | CIPDQYWUAVNLSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)