CAS 75895-54-4 appears in our catalog under these names: 3-Chloro-5-phenylphenol, 96%, 3-Chloro-5-phenylphenol, 96%, 96%, 5-Chloro-[1,1'-biphenyl]-3-ol, 96%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-chloro-5-phenylphenol (CAS 75895-54-4) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 3-chloro-5-phenylphenol. InChIKey: NOJLLJXVEWGKFB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3-chloro-5-phenylphenol |
| InChIKey | NOJLLJXVEWGKFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)O |
Computed by PubChem (NCBI)