Products 5121-00-6
CAS 5121-00-6 appears in our catalog under these names: 2-(1-Naphthyl)ethanoyl chloride, 95%, 1-Naphthylacetyl chloride, 95% , 2-(1-Naphthyl)ethanoyl chloride, 95% , 2-(Naphthalen-1-yl)acetyl chloride 95%, Naphth-1-ylacetyl chloride. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
2-naphthalen-1-ylacetyl chloride (CAS 5121-00-6) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 2-naphthalen-1-ylacetyl chloride. InChIKey: DSVAZLXLRDXHKO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-naphthalen-1-ylacetyl chloride |
| InChIKey | DSVAZLXLRDXHKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(naphthalen-1-yl)acetyl chloride, 2-(1-Naphthyl)Ethanoyl Chloride, 1-Naphthylacetyl Chloride, 2-naphthalen-1-ylacetyl chloride, Naphth-1-ylacetyl chloride, (naphth-1-yl)acetyl chloride, 1-naphthylacetylchloride, 1-Naphthaleneacetyl chloride, 2-(Naphth-1-yl)ethanoyl chloride, napthylacetyl chloride