CAS 92-04-6 appears in our catalog under these names: 2-Chloro-4-phenylphenol, 96%, 3-Chloro-(1,1'-biphenyl)-4-ol, 97%, 2–Chloro–4–phenylphenol, 2-Chloro-4-phenylphenol, >96.0%(GC), 2-Chloro-4-phenylphenol, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 1x1000mg.
2-chloro-4-phenylphenol (CAS 92-04-6) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 2-chloro-4-phenylphenol. InChIKey: BZWMYDJJDBFAPE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-chloro-4-phenylphenol |
| InChIKey | BZWMYDJJDBFAPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)