2-(Phenylamino)pyrimidine-4-carboxylic acid, 95%
cas: 1360802-78-3 — see every product listed under this CAS number, including other names
2-(Phenylamino)pyrimidine-4-carboxylic acid, 95% (CAS 1360802-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1121820-250mg |
| cas | 1360802-78-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 2517.50 Pln | |
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| BLDpharm | 100mg | 647.57 Pln | |
| BLDpharm | 250mg | 1047.43 Pln | |
| BLDpharm | 1g | 2707.96 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 1g | 4704.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-anilinopyrimidine-4-carboxylic acid (CAS 1360802-78-3) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 2-anilinopyrimidine-4-carboxylic acid. InChIKey: JFKQLLDYEIYMQH-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 2-anilinopyrimidine-4-carboxylic acid |
| InChIKey | JFKQLLDYEIYMQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)