CAS 24068-29-9 is the registry number for 2-(4-Nitrophenylamino)pyridine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-(4-nitrophenyl)pyridin-2-amine (CAS 24068-29-9) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: N-(4-nitrophenyl)pyridin-2-amine. InChIKey: XIULWQATZCLFGN-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | N-(4-nitrophenyl)pyridin-2-amine |
| InChIKey | XIULWQATZCLFGN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)