CAS 222987-21-5 appears in our catalog under these names: 4–(2–Aminopyrimidin–5–yl)benzoic acid, 4-(2-Aminopyrimidin-5-yl)benzoic acid, 98%, 4-(2-Aminopyrimidin-5-yl)benzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 100g, 25g, 1g, 100mg, 250mg.
4-(2-aminopyrimidin-5-yl)benzoic acid (CAS 222987-21-5) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 4-(2-aminopyrimidin-5-yl)benzoic acid. InChIKey: AHHQGKDKFINLBL-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 4-(2-aminopyrimidin-5-yl)benzoic acid |
| InChIKey | AHHQGKDKFINLBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)N)C(=O)O |
Computed by PubChem (NCBI)