Products 914349-45-4

CAS 914349-45-4 is the registry number for 3-(2-Aminopyrimidin-5-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(2-aminopyrimidin-5-yl)benzoic acid (CAS 914349-45-4) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 3-(2-aminopyrimidin-5-yl)benzoic acid. InChIKey: QFVFXTMOJRFRPF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9N3O2
Molecular weight215.21 g/mol
IUPAC name3-(2-aminopyrimidin-5-yl)benzoic acid
InChIKeyQFVFXTMOJRFRPF-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CN=C(N=C2)N

Computed by PubChem (NCBI)